C15H22N4O5 — CID 168596836
1-[4-(2,3-dihydroxypropylamino)-2-nitrophenyl]piperidine-4-carboxamide (PubChem CID 168596836) has the molecular formula C15H22N4O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-[4-(2,3-dihydroxypropylamino)-2-nitrophenyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(2,3-dihydroxypropylamino)-2-nitrophenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 168596836 |
| Molecular Formula | C15H22N4O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[4-(2,3-dihydroxypropylamino)-2-nitrophenyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ccc(NCC(O)CO)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H22N4O5/c16-15(22)10-3-5-18(6-4-10)13-2-1-11(7-14(13)19(23)24)17-8-12(21)9-20/h1-2,7,10,12,17,20-21H,3-6,8-9H2,(H2,16,22) |
| InChIKey | ZYOHTPCCMHRUFX-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|