C10H12N2O7 — CID 168596370
5-(2,3-dihydroxypropylamino)-2-hydroxy-3-nitrobenzoic acid (PubChem CID 168596370) has the molecular formula C10H12N2O7 and a molecular weight of 272.21 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropylamino)-2-hydroxy-3-nitrobenzoic acid.
| Compound Name | 5-(2,3-dihydroxypropylamino)-2-hydroxy-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 168596370 |
| Molecular Formula | C10H12N2O7 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 5-(2,3-dihydroxypropylamino)-2-hydroxy-3-nitrobenzoic acid |
| SMILES | O=C(O)c1cc(NCC(O)CO)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C10H12N2O7/c13-4-6(14)3-11-5-1-7(10(16)17)9(15)8(2-5)12(18)19/h1-2,6,11,13-15H,3-4H2,(H,16,17) |
| InChIKey | XNCMMUHBVNJNHV-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 153.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|