C11H11F3N2O6 — CID 168594137
2-(2,3-dihydroxypropylamino)-3-nitro-5-(trifluoromethyl)benzoic acid (PubChem CID 168594137) has the molecular formula C11H11F3N2O6 and a molecular weight of 324.21 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-3-nitro-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(2,3-dihydroxypropylamino)-3-nitro-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 168594137 |
| Molecular Formula | C11H11F3N2O6 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-3-nitro-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(C(F)(F)F)cc([N+](=O)[O-])c1NCC(O)CO |
| InChI | InChI=1S/C11H11F3N2O6/c12-11(13,14)5-1-7(10(19)20)9(8(2-5)16(21)22)15-3-6(18)4-17/h1-2,6,15,17-18H,3-4H2,(H,19,20) |
| InChIKey | NNKVNBHEIWFGBE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|