C12H18ClN3O7 — CID 91447366
3-[2-chloro-4-(2,3-dihydroxypropylamino)-3-hydroxy-5-nitroanilino]propane-1,2-diol (PubChem CID 91447366) has the molecular formula C12H18ClN3O7 and a molecular weight of 351.74 g/mol. Its IUPAC name is 3-[2-chloro-4-(2,3-dihydroxypropylamino)-3-hydroxy-5-nitroanilino]propane-1,2-diol.
| Compound Name | 3-[2-chloro-4-(2,3-dihydroxypropylamino)-3-hydroxy-5-nitroanilino]propane-1,2-diol |
|---|---|
| PubChem CID | 91447366 |
| Molecular Formula | C12H18ClN3O7 |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 3-[2-chloro-4-(2,3-dihydroxypropylamino)-3-hydroxy-5-nitroanilino]propane-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(NCC(O)CO)c(Cl)c(O)c1NCC(O)CO |
| InChI | InChI=1S/C12H18ClN3O7/c13-10-8(14-2-6(19)4-17)1-9(16(22)23)11(12(10)21)15-3-7(20)5-18/h1,6-7,14-15,17-21H,2-5H2 |
| InChIKey | HYSYIPOGYXZDKC-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 168.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|