C9H9F3N2O4 — CID 168594296
3-(3,4,6-trifluoro-2-nitroanilino)propane-1,2-diol (PubChem CID 168594296) has the molecular formula C9H9F3N2O4 and a molecular weight of 266.17 g/mol. Its IUPAC name is 3-(3,4,6-trifluoro-2-nitroanilino)propane-1,2-diol.
| Compound Name | 3-(3,4,6-trifluoro-2-nitroanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168594296 |
| Molecular Formula | C9H9F3N2O4 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-(3,4,6-trifluoro-2-nitroanilino)propane-1,2-diol |
| SMILES | O=[N+]([O-])c1c(F)c(F)cc(F)c1NCC(O)CO |
| InChI | InChI=1S/C9H9F3N2O4/c10-5-1-6(11)8(13-2-4(16)3-15)9(7(5)12)14(17)18/h1,4,13,15-16H,2-3H2 |
| InChIKey | YYEGDIHXLHGZAS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|