C10H11BrN2O6 — CID 168597480
3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid (PubChem CID 168597480) has the molecular formula C10H11BrN2O6 and a molecular weight of 335.11 g/mol. Its IUPAC name is 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid.
| Compound Name | 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 168597480 |
| Molecular Formula | C10H11BrN2O6 |
| Molecular Weight | 335.11 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid |
| SMILES | O=C(O)c1cc(Br)c(NCC(O)CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H11BrN2O6/c11-7-1-5(10(16)17)2-8(13(18)19)9(7)12-3-6(15)4-14/h1-2,6,12,14-15H,3-4H2,(H,16,17) |
| InChIKey | GXJRSUDRZZTIJK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.11 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|