3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid

C10H11BrN2O6 — CID 168597480

IUPAC3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid
SMILESO=C(O)c1cc(Br)c(NCC(O)CO)c([N+](=O)[O-])c1
InChIInChI=1S/C10H11BrN2O6/c11-7-1-5(10(16)17)2-8(13(18)19)9(7)12-3-6(15)4-14/h1-2,6,12,14-15H,3-4H2,(H,16,17)
InChIKeyGXJRSUDRZZTIJK-UHFFFAOYSA-N
MW335.11 g/mol
LogP0.82
Rot. Bonds6

About 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid

3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid (PubChem CID 168597480) has the molecular formula C10H11BrN2O6 and a molecular weight of 335.11 g/mol. Its IUPAC name is 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid.

Molecular Properties

Compound Name3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid
PubChem CID168597480
Molecular FormulaC10H11BrN2O6
Molecular Weight335.11 g/mol
Exact Mass333.98
IUPAC Name3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid
SMILESO=C(O)c1cc(Br)c(NCC(O)CO)c([N+](=O)[O-])c1
InChIInChI=1S/C10H11BrN2O6/c11-7-1-5(10(16)17)2-8(13(18)19)9(7)12-3-6(15)4-14/h1-2,6,12,14-15H,3-4H2,(H,16,17)
InChIKeyGXJRSUDRZZTIJK-UHFFFAOYSA-N
XLogP0.82
TPSA132.93 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500335.11
LogP ≤ 50.82
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid?
The IUPAC name of 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid (CID 168597480) is 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid.
What is the SMILES notation for 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid?
The canonical SMILES for 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid is O=C(O)c1cc(Br)c(NCC(O)CO)c([N+](=O)[O-])c1.
What is the InChIKey of 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid?
The InChIKey is GXJRSUDRZZTIJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2O6/c11-7-1-5(10(16)17)2-8(13(18)19)9(7)12-3-6(15)4-14/h1-2,6,12,14-15H,3-4H2,(H,16,17).
What are the key properties of 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid?
3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid has a molecular weight of 335.11 g/mol, XLogP of 0.82, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-(2,3-dihydroxypropylamino)-5-nitrobenzoic acid is sourced from PubChem (CID 168597480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).