C10H13BrN2O4 — CID 168593383
3-(4-bromo-2-methyl-6-nitroanilino)propane-1,2-diol (PubChem CID 168593383) has the molecular formula C10H13BrN2O4 and a molecular weight of 305.13 g/mol. Its IUPAC name is 3-(4-bromo-2-methyl-6-nitroanilino)propane-1,2-diol.
| Compound Name | 3-(4-bromo-2-methyl-6-nitroanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168593383 |
| Molecular Formula | C10H13BrN2O4 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 3-(4-bromo-2-methyl-6-nitroanilino)propane-1,2-diol |
| SMILES | Cc1cc(Br)cc([N+](=O)[O-])c1NCC(O)CO |
| InChI | InChI=1S/C10H13BrN2O4/c1-6-2-7(11)3-9(13(16)17)10(6)12-4-8(15)5-14/h2-3,8,12,14-15H,4-5H2,1H3 |
| InChIKey | COJJVLOTUKFZEG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|