C11H14N2O6 — CID 168594007
2-(2,3-dihydroxypropylamino)-3-methyl-5-nitrobenzoic acid (PubChem CID 168594007) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-3-methyl-5-nitrobenzoic acid.
| Compound Name | 2-(2,3-dihydroxypropylamino)-3-methyl-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 168594007 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-3-methyl-5-nitrobenzoic acid |
| SMILES | Cc1cc([N+](=O)[O-])cc(C(=O)O)c1NCC(O)CO |
| InChI | InChI=1S/C11H14N2O6/c1-6-2-7(13(18)19)3-9(11(16)17)10(6)12-4-8(15)5-14/h2-3,8,12,14-15H,4-5H2,1H3,(H,16,17) |
| InChIKey | LZQDVNSKAOUAPG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|