C18H17BrClF2N3O5 — CID 147543164
3-bromo-N-[4-(2-chloro-2,2-difluoroethyl)phenyl]-4-[[(2S)-2,3-dihydroxypropyl]amino]-5-nitrobenzamide (PubChem CID 147543164) has the molecular formula C18H17BrClF2N3O5 and a molecular weight of 508.70 g/mol. Its IUPAC name is 3-bromo-N-[4-(2-chloro-2,2-difluoroethyl)phenyl]-4-[[(2S)-2,3-dihydroxypropyl]amino]-5-nitrobenzamide.
| Compound Name | 3-bromo-N-[4-(2-chloro-2,2-difluoroethyl)phenyl]-4-[[(2S)-2,3-dihydroxypropyl]amino]-5-nitrobenzamide |
|---|---|
| PubChem CID | 147543164 |
| Molecular Formula | C18H17BrClF2N3O5 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 507.00 |
| IUPAC Name | 3-bromo-N-[4-(2-chloro-2,2-difluoroethyl)phenyl]-4-[[(2S)-2,3-dihydroxypropyl]amino]-5-nitrobenzamide |
| SMILES | O=C(Nc1ccc(CC(F)(F)Cl)cc1)c1cc(Br)c(NC[C@H](O)CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17BrClF2N3O5/c19-14-5-11(6-15(25(29)30)16(14)23-8-13(27)9-26)17(28)24-12-3-1-10(2-4-12)7-18(20,21)22/h1-6,13,23,26-27H,7-9H2,(H,24,28)/t13-/m0/s1 |
| InChIKey | FPHXUHDYADIIBF-ZDUSSCGKSA-N |
| XLogP | 3.75 |
| TPSA | 124.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|