C8H11N3O6 — CID 71594897
5-(2,3-dihydroxypropylamino)-4-hydroxy-3-nitro-1H-pyridin-2-one (PubChem CID 71594897) has the molecular formula C8H11N3O6 and a molecular weight of 245.19 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropylamino)-4-hydroxy-3-nitro-1H-pyridin-2-one.
| Compound Name | 5-(2,3-dihydroxypropylamino)-4-hydroxy-3-nitro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 71594897 |
| Molecular Formula | C8H11N3O6 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 5-(2,3-dihydroxypropylamino)-4-hydroxy-3-nitro-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(NCC(O)CO)c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11N3O6/c12-3-4(13)1-9-5-2-10-8(15)6(7(5)14)11(16)17/h2,4,9,12-13H,1,3H2,(H2,10,14,15) |
| InChIKey | MIODENUEKCMFKX-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 148.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|