C9H13N3O5 — CID 171858342
3-[1,2-dihydroxy-3-(methylamino)propyl]-5-nitro-1H-pyridin-2-one (PubChem CID 171858342) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is 3-[1,2-dihydroxy-3-(methylamino)propyl]-5-nitro-1H-pyridin-2-one.
| Compound Name | 3-[1,2-dihydroxy-3-(methylamino)propyl]-5-nitro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 171858342 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 3-[1,2-dihydroxy-3-(methylamino)propyl]-5-nitro-1H-pyridin-2-one |
| SMILES | CNCC(O)C(O)c1cc([N+](=O)[O-])c[nH]c1=O |
| InChI | InChI=1S/C9H13N3O5/c1-10-4-7(13)8(14)6-2-5(12(16)17)3-11-9(6)15/h2-3,7-8,10,13-14H,4H2,1H3,(H,11,15) |
| InChIKey | FKQONESJQXSBPM-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 128.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|