C8H9BrN2O5 — CID 171860383
3-(3-bromo-1,2-dihydroxypropyl)-5-nitro-1H-pyridin-2-one (PubChem CID 171860383) has the molecular formula C8H9BrN2O5 and a molecular weight of 293.07 g/mol. Its IUPAC name is 3-(3-bromo-1,2-dihydroxypropyl)-5-nitro-1H-pyridin-2-one.
| Compound Name | 3-(3-bromo-1,2-dihydroxypropyl)-5-nitro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 171860383 |
| Molecular Formula | C8H9BrN2O5 |
| Molecular Weight | 293.07 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 3-(3-bromo-1,2-dihydroxypropyl)-5-nitro-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc([N+](=O)[O-])cc1C(O)C(O)CBr |
| InChI | InChI=1S/C8H9BrN2O5/c9-2-6(12)7(13)5-1-4(11(15)16)3-10-8(5)14/h1,3,6-7,12-13H,2H2,(H,10,14) |
| InChIKey | MWZIHTULUALJHC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.07 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|