C8H11BrN2O4 — CID 171891694
4-(4-bromo-1,2-dihydroxybutyl)-1,2-dihydropyridazine-3,6-dione (PubChem CID 171891694) has the molecular formula C8H11BrN2O4 and a molecular weight of 279.09 g/mol. Its IUPAC name is 4-(4-bromo-1,2-dihydroxybutyl)-1,2-dihydropyridazine-3,6-dione.
| Compound Name | 4-(4-bromo-1,2-dihydroxybutyl)-1,2-dihydropyridazine-3,6-dione |
|---|---|
| PubChem CID | 171891694 |
| Molecular Formula | C8H11BrN2O4 |
| Molecular Weight | 279.09 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 4-(4-bromo-1,2-dihydroxybutyl)-1,2-dihydropyridazine-3,6-dione |
| SMILES | O=c1cc(C(O)C(O)CCBr)c(=O)[nH][nH]1 |
| InChI | InChI=1S/C8H11BrN2O4/c9-2-1-5(12)7(14)4-3-6(13)10-11-8(4)15/h3,5,7,12,14H,1-2H2,(H,10,13)(H,11,15) |
| InChIKey | NLOKHYXQXOQPHV-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.09 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|