C10H10BrF2NO4 — CID 171892698
4-bromo-1-(4,5-difluoro-2-nitrophenyl)butane-1,2-diol (PubChem CID 171892698) has the molecular formula C10H10BrF2NO4 and a molecular weight of 326.09 g/mol. Its IUPAC name is 4-bromo-1-(4,5-difluoro-2-nitrophenyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(4,5-difluoro-2-nitrophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171892698 |
| Molecular Formula | C10H10BrF2NO4 |
| Molecular Weight | 326.09 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 4-bromo-1-(4,5-difluoro-2-nitrophenyl)butane-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(F)c(F)cc1C(O)C(O)CCBr |
| InChI | InChI=1S/C10H10BrF2NO4/c11-2-1-9(15)10(16)5-3-6(12)7(13)4-8(5)14(17)18/h3-4,9-10,15-16H,1-2H2 |
| InChIKey | AFPKNDMHLZBOEK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.09 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|