C9H10BrClN2O4 — CID 171892378
4-bromo-1-(6-chloro-5-nitro-3-pyridinyl)butane-1,2-diol (PubChem CID 171892378) has the molecular formula C9H10BrClN2O4 and a molecular weight of 325.55 g/mol. Its IUPAC name is 4-bromo-1-(6-chloro-5-nitro-3-pyridinyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(6-chloro-5-nitro-3-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171892378 |
| Molecular Formula | C9H10BrClN2O4 |
| Molecular Weight | 325.55 g/mol |
| Exact Mass | 323.95 |
| IUPAC Name | 4-bromo-1-(6-chloro-5-nitro-3-pyridinyl)butane-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(C(O)C(O)CCBr)cnc1Cl |
| InChI | InChI=1S/C9H10BrClN2O4/c10-2-1-7(14)8(15)5-3-6(13(16)17)9(11)12-4-5/h3-4,7-8,14-15H,1-2H2 |
| InChIKey | ZTJCCZYIRUWGAH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.55 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|