C7H4ClF3N2O2 — CID 87510432
2-chloro-3-nitro-5-(1,2,2-trifluoroethyl)pyridine (PubChem CID 87510432) has the molecular formula C7H4ClF3N2O2 and a molecular weight of 240.57 g/mol. Its IUPAC name is 2-chloro-3-nitro-5-(1,2,2-trifluoroethyl)pyridine.
| Compound Name | 2-chloro-3-nitro-5-(1,2,2-trifluoroethyl)pyridine |
|---|---|
| PubChem CID | 87510432 |
| Molecular Formula | C7H4ClF3N2O2 |
| Molecular Weight | 240.57 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 2-chloro-3-nitro-5-(1,2,2-trifluoroethyl)pyridine |
| SMILES | O=[N+]([O-])c1cc(C(F)C(F)F)cnc1Cl |
| InChI | InChI=1S/C7H4ClF3N2O2/c8-6-4(13(14)15)1-3(2-12-6)5(9)7(10)11/h1-2,5,7H |
| InChIKey | PGQADKFJBLEDQJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|