About 2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride
2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride (PubChem CID 158145766) has the molecular formula C6H2Cl4F3N2O3P
and a molecular weight of 379.87 g/mol. Its IUPAC name is 2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride.
Molecular Properties
| Compound Name | 2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride |
| PubChem CID | 158145766 |
| Molecular Formula | C6H2Cl4F3N2O3P |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 377.85 |
| IUPAC Name | 2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride |
| SMILES | O=P(Cl)(Cl)Cl.O=[N+]([O-])c1cc(C(F)(F)F)cnc1Cl |
| InChI | InChI=1S/C6H2ClF3N2O2.Cl3OP/c7-5-4(12(13)14)1-3(2-11-5)6(8,9)10;1-5(2,3)4/h1-2H; |
| InChIKey | FUMNUOWVANECAB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride?
The IUPAC name of 2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride (CID 158145766) is 2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride.
What is the SMILES notation for 2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride?
The canonical SMILES for 2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride is O=P(Cl)(Cl)Cl.O=[N+]([O-])c1cc(C(F)(F)F)cnc1Cl.
What is the InChIKey of 2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride?
The InChIKey is FUMNUOWVANECAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2ClF3N2O2.Cl3OP/c7-5-4(12(13)14)1-3(2-11-5)6(8,9)10;1-5(2,3)4/h1-2H;.
What are the key properties of 2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride?
2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride has a molecular weight of 379.87 g/mol, XLogP of 5.47, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-nitro-5-(trifluoromethyl)pyridine;phosphoryl trichloride is sourced from PubChem (CID 158145766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).