C8H4F3N2NaO4 — CID 139026452
sodium 2-[3-nitro-5-(trifluoromethyl)-2-pyridinyl]acetate (PubChem CID 139026452) has the molecular formula C8H4F3N2NaO4 and a molecular weight of 272.11 g/mol. Its IUPAC name is sodium 2-[3-nitro-5-(trifluoromethyl)-2-pyridinyl]acetate.
| Compound Name | sodium 2-[3-nitro-5-(trifluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 139026452 |
| Molecular Formula | C8H4F3N2NaO4 |
| Molecular Weight | 272.11 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | sodium 2-[3-nitro-5-(trifluoromethyl)-2-pyridinyl]acetate |
| SMILES | O=C([O-])Cc1ncc(C(F)(F)F)cc1[N+](=O)[O-].[Na+] |
| InChI | InChI=1S/C8H5F3N2O4.Na/c9-8(10,11)4-1-6(13(16)17)5(12-3-4)2-7(14)15;/h1,3H,2H2,(H,14,15);/q;+1/p-1 |
| InChIKey | AVSSKDIOQSOYQI-UHFFFAOYSA-M |
| XLogP | -2.69 |
| TPSA | 96.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.11 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|