C10H9F3N2O4 — CID 121216107
ethyl 2-[3-nitro-5-(trifluoromethyl)-2-pyridinyl]acetate (PubChem CID 121216107) has the molecular formula C10H9F3N2O4 and a molecular weight of 278.19 g/mol. Its IUPAC name is ethyl 2-[3-nitro-5-(trifluoromethyl)-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[3-nitro-5-(trifluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 121216107 |
| Molecular Formula | C10H9F3N2O4 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | ethyl 2-[3-nitro-5-(trifluoromethyl)-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1ncc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9F3N2O4/c1-2-19-9(16)4-7-8(15(17)18)3-6(5-14-7)10(11,12)13/h3,5H,2,4H2,1H3 |
| InChIKey | MYEAFNOUSHSOIF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|