C15H11BrF3N3O3S — CID 167506629
1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-2-[3-nitro-5-(trifluoromethyl)-2-pyridinyl]ethanone (PubChem CID 167506629) has the molecular formula C15H11BrF3N3O3S and a molecular weight of 450.24 g/mol. Its IUPAC name is 1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-2-[3-nitro-5-(trifluoromethyl)-2-pyridinyl]ethanone.
| Compound Name | 1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-2-[3-nitro-5-(trifluoromethyl)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 167506629 |
| Molecular Formula | C15H11BrF3N3O3S |
| Molecular Weight | 450.24 g/mol |
| Exact Mass | 448.97 |
| IUPAC Name | 1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-2-[3-nitro-5-(trifluoromethyl)-2-pyridinyl]ethanone |
| SMILES | CCSc1cc(Br)cnc1C(=O)Cc1ncc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11BrF3N3O3S/c1-2-26-13-4-9(16)7-21-14(13)12(23)5-10-11(22(24)25)3-8(6-20-10)15(17,18)19/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | XLIKIIXEOWKYKR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 85.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.24 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|