C18H18F3N5O2S — CID 142513307
N-ethyl-5-ethylsulfanyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-2-nitroaniline (PubChem CID 142513307) has the molecular formula C18H18F3N5O2S and a molecular weight of 425.44 g/mol. Its IUPAC name is N-ethyl-5-ethylsulfanyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-2-nitroaniline.
| Compound Name | N-ethyl-5-ethylsulfanyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-2-nitroaniline |
|---|---|
| PubChem CID | 142513307 |
| Molecular Formula | C18H18F3N5O2S |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-ethyl-5-ethylsulfanyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-2-nitroaniline |
| SMILES | CCNc1cc(SCC)c(-c2nc3cc(C(F)(F)F)cnc3n2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18F3N5O2S/c1-4-22-12-8-15(29-5-2)11(7-14(12)26(27)28)16-24-13-6-10(18(19,20)21)9-23-17(13)25(16)3/h6-9,22H,4-5H2,1-3H3 |
| InChIKey | FKCSOLBKQCEDTQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|