C16H16F3N7S — CID 162598679
N-amino-N-[5-ethylsulfanyl-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-2-pyridinyl]methanimidamide (PubChem CID 162598679) has the molecular formula C16H16F3N7S and a molecular weight of 395.41 g/mol. Its IUPAC name is N-amino-N-[5-ethylsulfanyl-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-2-pyridinyl]methanimidamide.
| Compound Name | N-amino-N-[5-ethylsulfanyl-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-2-pyridinyl]methanimidamide |
|---|---|
| PubChem CID | 162598679 |
| Molecular Formula | C16H16F3N7S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-amino-N-[5-ethylsulfanyl-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-2-pyridinyl]methanimidamide |
| SMILES | [H]/N=C/N(N)c1ccc(SCC)c(-c2nc3cc(C(F)(F)F)cnc3n2C)n1 |
| InChI | InChI=1S/C16H16F3N7S/c1-3-27-11-4-5-12(26(21)8-20)24-13(11)15-23-10-6-9(16(17,18)19)7-22-14(10)25(15)2/h4-8,20H,3,21H2,1-2H3/b20-8+ |
| InChIKey | QZAHKQBRIBSTGZ-DNTJNYDQSA-N |
| XLogP | 3.45 |
| TPSA | 96.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|