C16H14ClF3N4O2S — CID 162611112
2-chloro-4-ethylsulfanyl-N,N-dihydroxy-5-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]aniline (PubChem CID 162611112) has the molecular formula C16H14ClF3N4O2S and a molecular weight of 418.83 g/mol. Its IUPAC name is 2-chloro-4-ethylsulfanyl-N,N-dihydroxy-5-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]aniline.
| Compound Name | 2-chloro-4-ethylsulfanyl-N,N-dihydroxy-5-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]aniline |
|---|---|
| PubChem CID | 162611112 |
| Molecular Formula | C16H14ClF3N4O2S |
| Molecular Weight | 418.83 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 2-chloro-4-ethylsulfanyl-N,N-dihydroxy-5-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]aniline |
| SMILES | CCSc1cc(Cl)c(N(O)O)cc1-c1nc2cc(C(F)(F)F)cnc2n1C |
| InChI | InChI=1S/C16H14ClF3N4O2S/c1-3-27-13-6-10(17)12(24(25)26)5-9(13)14-22-11-4-8(16(18,19)20)7-21-15(11)23(14)2/h4-7,25-26H,3H2,1-2H3 |
| InChIKey | VEFIESVKXQLAAP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.83 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|