About 2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine
2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (PubChem CID 149142899) has the molecular formula C15H13F3N4
and a molecular weight of 306.29 g/mol. Its IUPAC name is 2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine |
| PubChem CID | 149142899 |
| Molecular Formula | C15H13F3N4 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine |
| SMILES | Cc1ccc(C)c(-c2nc3cc(C(F)(F)F)cnc3n2C)n1 |
| InChI | InChI=1S/C15H13F3N4/c1-8-4-5-9(2)20-12(8)14-21-11-6-10(15(16,17)18)7-19-13(11)22(14)3/h4-7H,1-3H3 |
| InChIKey | RIMDZNUWVIUZRS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine?
The IUPAC name of 2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (CID 149142899) is 2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine.
What is the SMILES notation for 2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine?
The canonical SMILES for 2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine is Cc1ccc(C)c(-c2nc3cc(C(F)(F)F)cnc3n2C)n1.
What is the InChIKey of 2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine?
The InChIKey is RIMDZNUWVIUZRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N4/c1-8-4-5-9(2)20-12(8)14-21-11-6-10(15(16,17)18)7-19-13(11)22(14)3/h4-7H,1-3H3.
What are the key properties of 2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine?
2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine has a molecular weight of 306.29 g/mol, XLogP of 3.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dimethyl-2-pyridinyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine is sourced from PubChem (CID 149142899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).