C14H10F4N3P — CID 137468253
[2-fluoro-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]phenyl]phosphane (PubChem CID 137468253) has the molecular formula C14H10F4N3P and a molecular weight of 327.22 g/mol. Its IUPAC name is [2-fluoro-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]phenyl]phosphane.
| Compound Name | [2-fluoro-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 137468253 |
| Molecular Formula | C14H10F4N3P |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | [2-fluoro-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]phenyl]phosphane |
| SMILES | Cn1c(-c2cccc(F)c2P)nc2cc(C(F)(F)F)cnc21 |
| InChI | InChI=1S/C14H10F4N3P/c1-21-12(8-3-2-4-9(15)11(8)22)20-10-5-7(14(16,17)18)6-19-13(10)21/h2-6H,22H2,1H3 |
| InChIKey | DUYJNBDTNWBAIV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|