C17H13ClF3N5O2S — CID 131987430
2-[5-(4-chloro-2-ethylsulfanyl-5-nitrophenyl)-4-methyl-1,2,4-triazol-3-yl]-4-(trifluoromethyl)pyridine (PubChem CID 131987430) has the molecular formula C17H13ClF3N5O2S and a molecular weight of 443.84 g/mol. Its IUPAC name is 2-[5-(4-chloro-2-ethylsulfanyl-5-nitrophenyl)-4-methyl-1,2,4-triazol-3-yl]-4-(trifluoromethyl)pyridine.
| Compound Name | 2-[5-(4-chloro-2-ethylsulfanyl-5-nitrophenyl)-4-methyl-1,2,4-triazol-3-yl]-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 131987430 |
| Molecular Formula | C17H13ClF3N5O2S |
| Molecular Weight | 443.84 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 2-[5-(4-chloro-2-ethylsulfanyl-5-nitrophenyl)-4-methyl-1,2,4-triazol-3-yl]-4-(trifluoromethyl)pyridine |
| SMILES | CCSc1cc(Cl)c([N+](=O)[O-])cc1-c1nnc(-c2cc(C(F)(F)F)ccn2)n1C |
| InChI | InChI=1S/C17H13ClF3N5O2S/c1-3-29-14-8-11(18)13(26(27)28)7-10(14)15-23-24-16(25(15)2)12-6-9(4-5-22-12)17(19,20)21/h4-8H,3H2,1-2H3 |
| InChIKey | BOSUQLKXPMAYJN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|