C18H14ClF3N4O2 — CID 25358543
N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 25358543) has the molecular formula C18H14ClF3N4O2 and a molecular weight of 410.78 g/mol. Its IUPAC name is N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 25358543 |
| Molecular Formula | C18H14ClF3N4O2 |
| Molecular Weight | 410.78 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | Cn1ccnc1[C@H](Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClF3N4O2/c1-25-9-8-23-17(25)16(11-2-5-13(19)6-3-11)24-14-7-4-12(18(20,21)22)10-15(14)26(27)28/h2-10,16,24H,1H3/t16-/m1/s1 |
| InChIKey | UEWSWNFDXNOKNG-MRXNPFEDSA-N |
| XLogP | 5.20 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.78 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|