C20H18ClF3N4O4 — CID 41082791
5-chloro-N-[(S)-(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 41082791) has the molecular formula C20H18ClF3N4O4 and a molecular weight of 470.84 g/mol. Its IUPAC name is 5-chloro-N-[(S)-(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | 5-chloro-N-[(S)-(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 41082791 |
| Molecular Formula | C20H18ClF3N4O4 |
| Molecular Weight | 470.84 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 5-chloro-N-[(S)-(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | COc1cc(OC)cc([C@H](Nc2cc(Cl)c(C(F)(F)F)cc2[N+](=O)[O-])c2nccn2C)c1 |
| InChI | InChI=1S/C20H18ClF3N4O4/c1-27-5-4-25-19(27)18(11-6-12(31-2)8-13(7-11)32-3)26-16-10-15(21)14(20(22,23)24)9-17(16)28(29)30/h4-10,18,26H,1-3H3/t18-/m0/s1 |
| InChIKey | UJCATTBTCZDCEH-SFHVURJKSA-N |
| XLogP | 5.22 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.84 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|