C17H16FN5O4S — CID 25372695
4-[[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-nitrobenzenesulfonamide (PubChem CID 25372695) has the molecular formula C17H16FN5O4S and a molecular weight of 405.41 g/mol. Its IUPAC name is 4-[[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 25372695 |
| Molecular Formula | C17H16FN5O4S |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 4-[[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-nitrobenzenesulfonamide |
| SMILES | Cn1ccnc1[C@@H](Nc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FN5O4S/c1-22-9-8-20-17(22)16(11-2-4-12(18)5-3-11)21-14-7-6-13(28(19,26)27)10-15(14)23(24)25/h2-10,16,21H,1H3,(H2,19,26,27)/t16-/m0/s1 |
| InChIKey | LDRXVLBSIVDRPN-INIZCTEOSA-N |
| XLogP | 2.32 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|