C20H19N5O4S — CID 56554121
N-[(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-6-nitro-1,3-benzothiazol-2-amine (PubChem CID 56554121) has the molecular formula C20H19N5O4S and a molecular weight of 425.47 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-6-nitro-1,3-benzothiazol-2-amine.
| Compound Name | N-[(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-6-nitro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 56554121 |
| Molecular Formula | C20H19N5O4S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-6-nitro-1,3-benzothiazol-2-amine |
| SMILES | COc1cc(OC)cc(C(Nc2nc3ccc([N+](=O)[O-])cc3s2)c2nccn2C)c1 |
| InChI | InChI=1S/C20H19N5O4S/c1-24-7-6-21-19(24)18(12-8-14(28-2)11-15(9-12)29-3)23-20-22-16-5-4-13(25(26)27)10-17(16)30-20/h4-11,18H,1-3H3,(H,22,23) |
| InChIKey | IMRSDECSOXULFD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|