C9H7F3N2O4S — CID 44589159
2-ethylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene (PubChem CID 44589159) has the molecular formula C9H7F3N2O4S and a molecular weight of 296.23 g/mol. Its IUPAC name is 2-ethylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene.
| Compound Name | 2-ethylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 44589159 |
| Molecular Formula | C9H7F3N2O4S |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 2-ethylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene |
| SMILES | CCSc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7F3N2O4S/c1-2-19-8-6(13(15)16)3-5(9(10,11)12)4-7(8)14(17)18/h3-4H,2H2,1H3 |
| InChIKey | JBKSYQDCCXIKGH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|