C12H12F3N3O5 — CID 4118311
N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-N-methylbutanamide (PubChem CID 4118311) has the molecular formula C12H12F3N3O5 and a molecular weight of 335.24 g/mol. Its IUPAC name is N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-N-methylbutanamide.
| Compound Name | N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 4118311 |
| Molecular Formula | C12H12F3N3O5 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-N-methylbutanamide |
| SMILES | CCCC(=O)N(C)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12F3N3O5/c1-3-4-10(19)16(2)11-8(17(20)21)5-7(12(13,14)15)6-9(11)18(22)23/h5-6H,3-4H2,1-2H3 |
| InChIKey | QKDMJNFXSJKTFH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|