C15H19F3N4O6 — CID 88836588
1-[2,6-dinitro-N-propyl-4-(trifluoromethyl)anilino]propyl N-methylcarbamate (PubChem CID 88836588) has the molecular formula C15H19F3N4O6 and a molecular weight of 408.33 g/mol. Its IUPAC name is 1-[2,6-dinitro-N-propyl-4-(trifluoromethyl)anilino]propyl N-methylcarbamate.
| Compound Name | 1-[2,6-dinitro-N-propyl-4-(trifluoromethyl)anilino]propyl N-methylcarbamate |
|---|---|
| PubChem CID | 88836588 |
| Molecular Formula | C15H19F3N4O6 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1-[2,6-dinitro-N-propyl-4-(trifluoromethyl)anilino]propyl N-methylcarbamate |
| SMILES | CCCN(c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-])C(CC)OC(=O)NC |
| InChI | InChI=1S/C15H19F3N4O6/c1-4-6-20(12(5-2)28-14(23)19-3)13-10(21(24)25)7-9(15(16,17)18)8-11(13)22(26)27/h7-8,12H,4-6H2,1-3H3,(H,19,23) |
| InChIKey | XTIVIYVXRFEXHZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|