C15H20F3N3O4 — CID 71355810
N,N-di(butan-2-yl)-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 71355810) has the molecular formula C15H20F3N3O4 and a molecular weight of 363.34 g/mol. Its IUPAC name is N,N-di(butan-2-yl)-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | N,N-di(butan-2-yl)-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 71355810 |
| Molecular Formula | C15H20F3N3O4 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N,N-di(butan-2-yl)-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | CCC(C)N(c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-])C(C)CC |
| InChI | InChI=1S/C15H20F3N3O4/c1-5-9(3)19(10(4)6-2)14-12(20(22)23)7-11(15(16,17)18)8-13(14)21(24)25/h7-10H,5-6H2,1-4H3 |
| InChIKey | KNTOUMMLMPJOSR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|