C7H2F3IN2O4 — CID 141165200
2-iodo-1,3-dinitro-5-(trifluoromethyl)benzene (PubChem CID 141165200) has the molecular formula C7H2F3IN2O4 and a molecular weight of 362.00 g/mol. Its IUPAC name is 2-iodo-1,3-dinitro-5-(trifluoromethyl)benzene.
| Compound Name | 2-iodo-1,3-dinitro-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 141165200 |
| Molecular Formula | C7H2F3IN2O4 |
| Molecular Weight | 362.00 g/mol |
| Exact Mass | 361.90 |
| IUPAC Name | 2-iodo-1,3-dinitro-5-(trifluoromethyl)benzene |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1I |
| InChI | InChI=1S/C7H2F3IN2O4/c8-7(9,10)3-1-4(12(14)15)6(11)5(2-3)13(16)17/h1-2H |
| InChIKey | JTHHBEUDTFAQHD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.00 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|