C9H4BrF6NO2 — CID 134618123
1-(bromomethyl)-3-nitro-2,5-bis(trifluoromethyl)benzene (PubChem CID 134618123) has the molecular formula C9H4BrF6NO2 and a molecular weight of 352.03 g/mol. Its IUPAC name is 1-(bromomethyl)-3-nitro-2,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(bromomethyl)-3-nitro-2,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 134618123 |
| Molecular Formula | C9H4BrF6NO2 |
| Molecular Weight | 352.03 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 1-(bromomethyl)-3-nitro-2,5-bis(trifluoromethyl)benzene |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc(CBr)c1C(F)(F)F |
| InChI | InChI=1S/C9H4BrF6NO2/c10-3-4-1-5(8(11,12)13)2-6(17(18)19)7(4)9(14,15)16/h1-2H,3H2 |
| InChIKey | QSLTWLFQSCAAJR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.03 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|