C10H5F6NO4 — CID 134645801
methyl 3-nitro-2,5-bis(trifluoromethyl)benzoate (PubChem CID 134645801) has the molecular formula C10H5F6NO4 and a molecular weight of 317.14 g/mol. Its IUPAC name is methyl 3-nitro-2,5-bis(trifluoromethyl)benzoate.
| Compound Name | methyl 3-nitro-2,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 134645801 |
| Molecular Formula | C10H5F6NO4 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | methyl 3-nitro-2,5-bis(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1cc(C(F)(F)F)cc([N+](=O)[O-])c1C(F)(F)F |
| InChI | InChI=1S/C10H5F6NO4/c1-21-8(18)5-2-4(9(11,12)13)3-6(17(19)20)7(5)10(14,15)16/h2-3H,1H3 |
| InChIKey | PYXJJNCETBQGKU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|