C8H6Br2N2O4 — CID 3532624
1,5-bis(bromomethyl)-2,4-dinitrobenzene (PubChem CID 3532624) has the molecular formula C8H6Br2N2O4 and a molecular weight of 353.95 g/mol. Its IUPAC name is 1,5-bis(bromomethyl)-2,4-dinitrobenzene.
| Compound Name | 1,5-bis(bromomethyl)-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 3532624 |
| Molecular Formula | C8H6Br2N2O4 |
| Molecular Weight | 353.95 g/mol |
| Exact Mass | 351.87 |
| IUPAC Name | 1,5-bis(bromomethyl)-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(CBr)cc1CBr |
| InChI | InChI=1S/C8H6Br2N2O4/c9-3-5-1-6(4-10)8(12(15)16)2-7(5)11(13)14/h1-2H,3-4H2 |
| InChIKey | LYNGOIGQKSFSCA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.95 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|