C7H5N3O7 — CID 53422846
(2,4,5-trinitrophenyl)methanol (PubChem CID 53422846) has the molecular formula C7H5N3O7 and a molecular weight of 243.13 g/mol. Its IUPAC name is (2,4,5-trinitrophenyl)methanol.
| Compound Name | (2,4,5-trinitrophenyl)methanol |
|---|---|
| PubChem CID | 53422846 |
| Molecular Formula | C7H5N3O7 |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | (2,4,5-trinitrophenyl)methanol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c([N+](=O)[O-])cc1CO |
| InChI | InChI=1S/C7H5N3O7/c11-3-4-1-6(9(14)15)7(10(16)17)2-5(4)8(12)13/h1-2,11H,3H2 |
| InChIKey | BPNHTEMKNUBRFW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|