C12H14F3N3O4 — CID 20503007
N-methyl-N-(2-methylpropyl)-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 20503007) has the molecular formula C12H14F3N3O4 and a molecular weight of 321.26 g/mol. Its IUPAC name is N-methyl-N-(2-methylpropyl)-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | N-methyl-N-(2-methylpropyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 20503007 |
| Molecular Formula | C12H14F3N3O4 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-methyl-N-(2-methylpropyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | CC(C)CN(C)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14F3N3O4/c1-7(2)6-16(3)11-9(17(19)20)4-8(12(13,14)15)5-10(11)18(21)22/h4-5,7H,6H2,1-3H3 |
| InChIKey | KMBFSJZBOMRXDQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|