C13H14F3N3O5 — CID 154139960
N-methyl-2,6-dinitro-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)aniline (PubChem CID 154139960) has the molecular formula C13H14F3N3O5 and a molecular weight of 349.27 g/mol. Its IUPAC name is N-methyl-2,6-dinitro-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)aniline.
| Compound Name | N-methyl-2,6-dinitro-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 154139960 |
| Molecular Formula | C13H14F3N3O5 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-methyl-2,6-dinitro-N-(oxolan-2-ylmethyl)-4-(trifluoromethyl)aniline |
| SMILES | CN(CC1CCCO1)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14F3N3O5/c1-17(7-9-3-2-4-24-9)12-10(18(20)21)5-8(13(14,15)16)6-11(12)19(22)23/h5-6,9H,2-4,7H2,1H3 |
| InChIKey | DAXDCEIZZPETRU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|