C16H17F3N2O — CID 133401090
N-methyl-N-(oxolan-2-ylmethyl)-7-(trifluoromethyl)quinolin-4-amine (PubChem CID 133401090) has the molecular formula C16H17F3N2O and a molecular weight of 310.32 g/mol. Its IUPAC name is N-methyl-N-(oxolan-2-ylmethyl)-7-(trifluoromethyl)quinolin-4-amine.
| Compound Name | N-methyl-N-(oxolan-2-ylmethyl)-7-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 133401090 |
| Molecular Formula | C16H17F3N2O |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-methyl-N-(oxolan-2-ylmethyl)-7-(trifluoromethyl)quinolin-4-amine |
| SMILES | CN(CC1CCCO1)c1ccnc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C16H17F3N2O/c1-21(10-12-3-2-8-22-12)15-6-7-20-14-9-11(16(17,18)19)4-5-13(14)15/h4-7,9,12H,2-3,8,10H2,1H3 |
| InChIKey | VNSFJWLLULFDEZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |