C14H17F3N4O5 — CID 159384902
3-N-ethyl-2,4-dinitro-3-N-(oxolan-2-ylmethyl)-6-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 159384902) has the molecular formula C14H17F3N4O5 and a molecular weight of 378.31 g/mol. Its IUPAC name is 3-N-ethyl-2,4-dinitro-3-N-(oxolan-2-ylmethyl)-6-(trifluoromethyl)benzene-1,3-diamine.
| Compound Name | 3-N-ethyl-2,4-dinitro-3-N-(oxolan-2-ylmethyl)-6-(trifluoromethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 159384902 |
| Molecular Formula | C14H17F3N4O5 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 3-N-ethyl-2,4-dinitro-3-N-(oxolan-2-ylmethyl)-6-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | CCN(CC1CCCO1)c1c([N+](=O)[O-])cc(C(F)(F)F)c(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17F3N4O5/c1-2-19(7-8-4-3-5-26-8)12-10(20(22)23)6-9(14(15,16)17)11(18)13(12)21(24)25/h6,8H,2-5,7,18H2,1H3 |
| InChIKey | LLJHJPIHGOJHHI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|