C12H12F3N3O6 — CID 88738949
N-methyl-N-[3-methyl-2,6-dinitro-4-(trifluoromethyl)phenyl]-1,3-dioxolan-2-amine (PubChem CID 88738949) has the molecular formula C12H12F3N3O6 and a molecular weight of 351.24 g/mol. Its IUPAC name is N-methyl-N-[3-methyl-2,6-dinitro-4-(trifluoromethyl)phenyl]-1,3-dioxolan-2-amine.
| Compound Name | N-methyl-N-[3-methyl-2,6-dinitro-4-(trifluoromethyl)phenyl]-1,3-dioxolan-2-amine |
|---|---|
| PubChem CID | 88738949 |
| Molecular Formula | C12H12F3N3O6 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-methyl-N-[3-methyl-2,6-dinitro-4-(trifluoromethyl)phenyl]-1,3-dioxolan-2-amine |
| SMILES | Cc1c(C(F)(F)F)cc([N+](=O)[O-])c(N(C)C2OCCO2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12F3N3O6/c1-6-7(12(13,14)15)5-8(17(19)20)10(9(6)18(21)22)16(2)11-23-3-4-24-11/h5,11H,3-4H2,1-2H3 |
| InChIKey | MFIMIBMRHXCFGE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|