C12H12F3N3O6S — CID 18801506
N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-N-methyl-1,1-dioxothiolan-3-amine (PubChem CID 18801506) has the molecular formula C12H12F3N3O6S and a molecular weight of 383.30 g/mol. Its IUPAC name is N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-N-methyl-1,1-dioxothiolan-3-amine.
| Compound Name | N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-N-methyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 18801506 |
| Molecular Formula | C12H12F3N3O6S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-N-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CN(c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1C(F)(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H12F3N3O6S/c1-16(7-2-3-25(23,24)6-7)11-9(12(13,14)15)4-8(17(19)20)5-10(11)18(21)22/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | GRQIDYUDNYMNOH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|