C15H18F3N3O6S — CID 3843407
N-butyl-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine (PubChem CID 3843407) has the molecular formula C15H18F3N3O6S and a molecular weight of 425.39 g/mol. Its IUPAC name is N-butyl-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-butyl-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 3843407 |
| Molecular Formula | C15H18F3N3O6S |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | N-butyl-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine |
| SMILES | CCCCN(c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-])C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18F3N3O6S/c1-2-3-5-19(11-4-6-28(26,27)9-11)14-12(20(22)23)7-10(15(16,17)18)8-13(14)21(24)25/h7-8,11H,2-6,9H2,1H3 |
| InChIKey | LEHWSSBQEVOKGX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|