C15H9ClF3N3O5 — CID 20568551
N-(4-chloro-2-methylphenyl)-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]formamide (PubChem CID 20568551) has the molecular formula C15H9ClF3N3O5 and a molecular weight of 403.70 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]formamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]formamide |
|---|---|
| PubChem CID | 20568551 |
| Molecular Formula | C15H9ClF3N3O5 |
| Molecular Weight | 403.70 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]formamide |
| SMILES | Cc1cc(Cl)ccc1N(C=O)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C15H9ClF3N3O5/c1-8-4-9(16)2-3-12(8)20(7-23)14-11(15(17,18)19)5-10(21(24)25)6-13(14)22(26)27/h2-7H,1H3 |
| InChIKey | MSXUKLSLRCLCJT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|