C15H9F3N4O8 — CID 20568539
N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-N-(2-methoxy-5-nitrophenyl)formamide (PubChem CID 20568539) has the molecular formula C15H9F3N4O8 and a molecular weight of 430.25 g/mol. Its IUPAC name is N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-N-(2-methoxy-5-nitrophenyl)formamide.
| Compound Name | N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-N-(2-methoxy-5-nitrophenyl)formamide |
|---|---|
| PubChem CID | 20568539 |
| Molecular Formula | C15H9F3N4O8 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-N-(2-methoxy-5-nitrophenyl)formamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(C=O)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H9F3N4O8/c1-30-13-3-2-9(20(24)25)6-10(13)19(7-23)14-11(21(26)27)4-8(15(16,17)18)5-12(14)22(28)29/h2-7H,1H3 |
| InChIKey | FIWWGAIHZVZEQM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 158.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|