C9H11N3O5 — CID 50879932
2-methoxy-N,N-dimethyl-4,6-dinitroaniline (PubChem CID 50879932) has the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. Its IUPAC name is 2-methoxy-N,N-dimethyl-4,6-dinitroaniline.
| Compound Name | 2-methoxy-N,N-dimethyl-4,6-dinitroaniline |
|---|---|
| PubChem CID | 50879932 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-methoxy-N,N-dimethyl-4,6-dinitroaniline |
| SMILES | COc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N(C)C |
| InChI | InChI=1S/C9H11N3O5/c1-10(2)9-7(12(15)16)4-6(11(13)14)5-8(9)17-3/h4-5H,1-3H3 |
| InChIKey | JMJJWPIVSNLRHS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|