C7H6N6O11 — CID 88518271
N-methyl-N-(2,4,6-trinitrophenyl)nitramide;nitric acid (PubChem CID 88518271) has the molecular formula C7H6N6O11 and a molecular weight of 350.16 g/mol. Its IUPAC name is N-methyl-N-(2,4,6-trinitrophenyl)nitramide;nitric acid.
| Compound Name | N-methyl-N-(2,4,6-trinitrophenyl)nitramide;nitric acid |
|---|---|
| PubChem CID | 88518271 |
| Molecular Formula | C7H6N6O11 |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | N-methyl-N-(2,4,6-trinitrophenyl)nitramide;nitric acid |
| SMILES | CN(c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-])[N+](=O)[O-].O=[N+]([O-])O |
| InChI | InChI=1S/C7H5N5O8.HNO3/c1-8(12(19)20)7-5(10(15)16)2-4(9(13)14)3-6(7)11(17)18;2-1(3)4/h2-3H,1H3;(H,2,3,4) |
| InChIKey | NFEYYGZCGSQLCX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 239.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|